C18H22N2O — CID 4511559
N-benzyl-2-cyano-2-cyclooctylideneacetamide (PubChem CID 4511559) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is N-benzyl-2-cyano-2-cyclooctylideneacetamide.
| Compound Name | N-benzyl-2-cyano-2-cyclooctylideneacetamide |
|---|---|
| PubChem CID | 4511559 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | N-benzyl-2-cyano-2-cyclooctylideneacetamide |
| SMILES | N#CC(C(=O)NCc1ccccc1)=C1CCCCCCC1 |
| InChI | InChI=1S/C18H22N2O/c19-13-17(16-11-7-2-1-3-8-12-16)18(21)20-14-15-9-5-4-6-10-15/h4-6,9-10H,1-3,7-8,11-12,14H2,(H,20,21) |
| InChIKey | PRFPPMIGHKWMNO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|