C19H23ClN4OS — CID 136642384
1-[(2S)-6-chloro-4-(2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-yl)piperazin-2-yl]propan-2-ol (PubChem CID 136642384) has the molecular formula C19H23ClN4OS and a molecular weight of 390.94 g/mol. Its IUPAC name is 1-[(2S)-6-chloro-4-(2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-yl)piperazin-2-yl]propan-2-ol.
| Compound Name | 1-[(2S)-6-chloro-4-(2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-yl)piperazin-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 136642384 |
| Molecular Formula | C19H23ClN4OS |
| Molecular Weight | 390.94 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 1-[(2S)-6-chloro-4-(2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-yl)piperazin-2-yl]propan-2-ol |
| SMILES | Cc1cc2c(s1)Nc1ccccc1N=C2N1CC(Cl)N[C@@H](CC(C)O)C1 |
| InChI | InChI=1S/C19H23ClN4OS/c1-11(25)7-13-9-24(10-17(20)21-13)18-14-8-12(2)26-19(14)23-16-6-4-3-5-15(16)22-18/h3-6,8,11,13,17,21,23,25H,7,9-10H2,1-2H3/t11?,13-,17?/m0/s1 |
| InChIKey | CRDDVGSQRIWYNH-XKZABGERSA-N |
| XLogP | 3.80 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.94 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|