C27H39FN4S — CID 142812395
(E)-1-fluorobut-1-ene;(Z)-4-methylhex-2-ene;2-methyl-4-piperazin-1-yl-10H-thieno[2,3-b][1,5]benzodiazepine (PubChem CID 142812395) has the molecular formula C27H39FN4S and a molecular weight of 470.70 g/mol. Its IUPAC name is (E)-1-fluorobut-1-ene;(Z)-4-methylhex-2-ene;2-methyl-4-piperazin-1-yl-10H-thieno[2,3-b][1,5]benzodiazepine.
| Compound Name | (E)-1-fluorobut-1-ene;(Z)-4-methylhex-2-ene;2-methyl-4-piperazin-1-yl-10H-thieno[2,3-b][1,5]benzodiazepine |
|---|---|
| PubChem CID | 142812395 |
| Molecular Formula | C27H39FN4S |
| Molecular Weight | 470.70 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | (E)-1-fluorobut-1-ene;(Z)-4-methylhex-2-ene;2-methyl-4-piperazin-1-yl-10H-thieno[2,3-b][1,5]benzodiazepine |
| SMILES | C/C=C\C(C)CC.CC/C=C/F.Cc1cc2c(s1)Nc1ccccc1N=C2N1CCNCC1 |
| InChI | InChI=1S/C16H18N4S.C7H14.C4H7F/c1-11-10-12-15(20-8-6-17-7-9-20)18-13-4-2-3-5-14(13)19-16(12)21-11;1-4-6-7(3)5-2;1-2-3-4-5/h2-5,10,17,19H,6-9H2,1H3;4,6-7H,5H2,1-3H3;3-4H,2H2,1H3/b;6-4-;4-3+ |
| InChIKey | AHRQLVXIPPIJTB-WNMGETPVSA-N |
| XLogP | 7.59 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.70 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|