C30H39IN4OS — CID 160665965
1-(1-adamantyl)-3-[1-methyl-4-(2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-yl)piperazin-1-ium-1-yl]propan-1-one iodide (PubChem CID 160665965) has the molecular formula C30H39IN4OS and a molecular weight of 630.64 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[1-methyl-4-(2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-yl)piperazin-1-ium-1-yl]propan-1-one iodide.
| Compound Name | 1-(1-adamantyl)-3-[1-methyl-4-(2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-yl)piperazin-1-ium-1-yl]propan-1-one iodide |
|---|---|
| PubChem CID | 160665965 |
| Molecular Formula | C30H39IN4OS |
| Molecular Weight | 630.64 g/mol |
| Exact Mass | 630.19 |
| IUPAC Name | 1-(1-adamantyl)-3-[1-methyl-4-(2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-yl)piperazin-1-ium-1-yl]propan-1-one iodide |
| SMILES | Cc1cc2c(s1)Nc1ccccc1N=C2N1CC[N+](C)(CCC(=O)C23CC4CC(CC(C4)C2)C3)CC1.[I-] |
| InChI | InChI=1S/C30H39N4OS.HI/c1-20-13-24-28(31-25-5-3-4-6-26(25)32-29(24)36-20)33-8-11-34(2,12-9-33)10-7-27(35)30-17-21-14-22(18-30)16-23(15-21)19-30;/h3-6,13,21-23,32H,7-12,14-19H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | JNFAQVWQXPBKIA-UHFFFAOYSA-M |
| XLogP | 3.13 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.64 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|