C24H33N5O2S — CID 146660770
tert-butyl N-[3-[4-(2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-yl)piperazin-1-yl]propyl]carbamate (PubChem CID 146660770) has the molecular formula C24H33N5O2S and a molecular weight of 455.63 g/mol. Its IUPAC name is tert-butyl N-[3-[4-(2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-yl)piperazin-1-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-(2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-yl)piperazin-1-yl]propyl]carbamate |
|---|---|
| PubChem CID | 146660770 |
| Molecular Formula | C24H33N5O2S |
| Molecular Weight | 455.63 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | tert-butyl N-[3-[4-(2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-yl)piperazin-1-yl]propyl]carbamate |
| SMILES | Cc1cc2c(s1)Nc1ccccc1N=C2N1CCN(CCCNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C24H33N5O2S/c1-17-16-18-21(26-19-8-5-6-9-20(19)27-22(18)32-17)29-14-12-28(13-15-29)11-7-10-25-23(30)31-24(2,3)4/h5-6,8-9,16,27H,7,10-15H2,1-4H3,(H,25,30) |
| InChIKey | VIRHOFTXSYNELC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.63 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|