C25H36N5O2S+ — CID 135998128
[1-methyl-4-(2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-yl)piperazin-1-ium-1-yl]methyl N-hexylcarbamate (PubChem CID 135998128) has the molecular formula C25H36N5O2S+ and a molecular weight of 470.66 g/mol. Its IUPAC name is [1-methyl-4-(2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-yl)piperazin-1-ium-1-yl]methyl N-hexylcarbamate.
| Compound Name | [1-methyl-4-(2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-yl)piperazin-1-ium-1-yl]methyl N-hexylcarbamate |
|---|---|
| PubChem CID | 135998128 |
| Molecular Formula | C25H36N5O2S+ |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | [1-methyl-4-(2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-yl)piperazin-1-ium-1-yl]methyl N-hexylcarbamate |
| SMILES | CCCCCCNC(=O)OC[N+]1(C)CCN(C2=Nc3ccccc3Nc3sc(C)cc32)CC1 |
| InChI | InChI=1S/C25H35N5O2S/c1-4-5-6-9-12-26-25(31)32-18-30(3)15-13-29(14-16-30)23-20-17-19(2)33-24(20)28-22-11-8-7-10-21(22)27-23/h7-8,10-11,17H,4-6,9,12-16,18H2,1-3H3,(H-,26,27,28,31)/p+1 |
| InChIKey | KPSRZEJZYNKWOF-UHFFFAOYSA-O |
| XLogP | 5.22 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|