C25H32ClIN2O3 — CID 53261282
(9-chloro-4-methyl-13-oxa-4-azoniatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-4-yl)methyl N-hexylcarbamate iodide (PubChem CID 53261282) has the molecular formula C25H32ClIN2O3 and a molecular weight of 570.90 g/mol. Its IUPAC name is (9-chloro-4-methyl-13-oxa-4-azoniatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-4-yl)methyl N-hexylcarbamate iodide.
| Compound Name | (9-chloro-4-methyl-13-oxa-4-azoniatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-4-yl)methyl N-hexylcarbamate iodide |
|---|---|
| PubChem CID | 53261282 |
| Molecular Formula | C25H32ClIN2O3 |
| Molecular Weight | 570.90 g/mol |
| Exact Mass | 570.11 |
| IUPAC Name | (9-chloro-4-methyl-13-oxa-4-azoniatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-4-yl)methyl N-hexylcarbamate iodide |
| SMILES | CCCCCCNC(=O)OC[N+]1(C)CC2c3ccccc3Oc3ccc(Cl)cc3C2C1.[I-] |
| InChI | InChI=1S/C25H31ClN2O3.HI/c1-3-4-5-8-13-27-25(29)30-17-28(2)15-21-19-9-6-7-10-23(19)31-24-12-11-18(26)14-20(24)22(21)16-28;/h6-7,9-12,14,21-22H,3-5,8,13,15-17H2,1-2H3;1H |
| InChIKey | JQLNDMMGWCGRRG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.90 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|