C21H18ClNO5 — CID 173070406
(Z)-2-[(2R,4S,6S)-9-chloro-4-methyl-13-oxa-4-azoniatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-4-yl]-4-hydroxy-4-oxobut-2-enoate (PubChem CID 173070406) has the molecular formula C21H18ClNO5 and a molecular weight of 399.83 g/mol. Its IUPAC name is (Z)-2-[(2R,4S,6S)-9-chloro-4-methyl-13-oxa-4-azoniatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-4-yl]-4-hydroxy-4-oxobut-2-enoate.
| Compound Name | (Z)-2-[(2R,4S,6S)-9-chloro-4-methyl-13-oxa-4-azoniatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-4-yl]-4-hydroxy-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 173070406 |
| Molecular Formula | C21H18ClNO5 |
| Molecular Weight | 399.83 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | (Z)-2-[(2R,4S,6S)-9-chloro-4-methyl-13-oxa-4-azoniatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-4-yl]-4-hydroxy-4-oxobut-2-enoate |
| SMILES | C[N@@+]1(/C(=C\C(=O)O)C(=O)[O-])C[C@@H]2c3cc(Cl)ccc3Oc3ccccc3[C@@H]2C1 |
| InChI | InChI=1S/C21H18ClNO5/c1-23(17(21(26)27)9-20(24)25)10-15-13-4-2-3-5-18(13)28-19-7-6-12(22)8-14(19)16(15)11-23/h2-9,15-16H,10-11H2,1H3,(H-,24,25,26,27)/b17-9-/t15-,16+,23-/m0/s1 |
| InChIKey | OESQEVRTGAPGGS-XKUNKSCJSA-N |
| XLogP | 2.49 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.83 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|