C17H20I2N4OS — CID 162122170
[4-(4-methylpiperazin-1-yl)-10H-thieno[2,3-b][1,5]benzodiazepin-2-yl]methanol;molecular iodine (PubChem CID 162122170) has the molecular formula C17H20I2N4OS and a molecular weight of 582.25 g/mol. Its IUPAC name is [4-(4-methylpiperazin-1-yl)-10H-thieno[2,3-b][1,5]benzodiazepin-2-yl]methanol;molecular iodine.
| Compound Name | [4-(4-methylpiperazin-1-yl)-10H-thieno[2,3-b][1,5]benzodiazepin-2-yl]methanol;molecular iodine |
|---|---|
| PubChem CID | 162122170 |
| Molecular Formula | C17H20I2N4OS |
| Molecular Weight | 582.25 g/mol |
| Exact Mass | 581.94 |
| IUPAC Name | [4-(4-methylpiperazin-1-yl)-10H-thieno[2,3-b][1,5]benzodiazepin-2-yl]methanol;molecular iodine |
| SMILES | CN1CCN(C2=Nc3ccccc3Nc3sc(CO)cc32)CC1.II |
| InChI | InChI=1S/C17H20N4OS.I2/c1-20-6-8-21(9-7-20)16-13-10-12(11-22)23-17(13)19-15-5-3-2-4-14(15)18-16;1-2/h2-5,10,19,22H,6-9,11H2,1H3; |
| InChIKey | ZHOCEUNGQVMXTF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.25 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|