C19H26N4 — CID 170150290
2-methyl-4-(4-methylpiperazin-1-yl)-3-(2-methylprop-2-enyl)-1H-1,5-benzodiazepine (PubChem CID 170150290) has the molecular formula C19H26N4 and a molecular weight of 310.45 g/mol. Its IUPAC name is 2-methyl-4-(4-methylpiperazin-1-yl)-3-(2-methylprop-2-enyl)-1H-1,5-benzodiazepine.
| Compound Name | 2-methyl-4-(4-methylpiperazin-1-yl)-3-(2-methylprop-2-enyl)-1H-1,5-benzodiazepine |
|---|---|
| PubChem CID | 170150290 |
| Molecular Formula | C19H26N4 |
| Molecular Weight | 310.45 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | 2-methyl-4-(4-methylpiperazin-1-yl)-3-(2-methylprop-2-enyl)-1H-1,5-benzodiazepine |
| SMILES | C=C(C)CC1=C(C)Nc2ccccc2N=C1N1CCN(C)CC1 |
| InChI | InChI=1S/C19H26N4/c1-14(2)13-16-15(3)20-17-7-5-6-8-18(17)21-19(16)23-11-9-22(4)10-12-23/h5-8,20H,1,9-13H2,2-4H3 |
| InChIKey | GWXYUCAUFJDVRN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|