C18H17F2N3O — CID 67474887
1,8-difluoro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepine (PubChem CID 67474887) has the molecular formula C18H17F2N3O and a molecular weight of 329.35 g/mol. Its IUPAC name is 1,8-difluoro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepine.
| Compound Name | 1,8-difluoro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepine |
|---|---|
| PubChem CID | 67474887 |
| Molecular Formula | C18H17F2N3O |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 1,8-difluoro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepine |
| SMILES | CN1CCN(C2=Nc3cccc(F)c3Oc3ccc(F)cc32)CC1 |
| InChI | InChI=1S/C18H17F2N3O/c1-22-7-9-23(10-8-22)18-13-11-12(19)5-6-16(13)24-17-14(20)3-2-4-15(17)21-18/h2-6,11H,7-10H2,1H3 |
| InChIKey | VCZIUVRTXIHSJR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |