C9H13Cl3N2O — CID 141019823
2-methyl-2H-1,4-benzoxazin-3-amine;trihydrochloride (PubChem CID 141019823) has the molecular formula C9H13Cl3N2O and a molecular weight of 271.57 g/mol. Its IUPAC name is 2-methyl-2H-1,4-benzoxazin-3-amine;trihydrochloride.
| Compound Name | 2-methyl-2H-1,4-benzoxazin-3-amine;trihydrochloride |
|---|---|
| PubChem CID | 141019823 |
| Molecular Formula | C9H13Cl3N2O |
| Molecular Weight | 271.57 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | 2-methyl-2H-1,4-benzoxazin-3-amine;trihydrochloride |
| SMILES | CC1Oc2ccccc2N=C1N.Cl.Cl.Cl |
| InChI | InChI=1S/C9H10N2O.3ClH/c1-6-9(10)11-7-4-2-3-5-8(7)12-6;;;/h2-6H,1H3,(H2,10,11);3*1H |
| InChIKey | QUKJUCUCKFSUQH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.57 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |