C8H7NOS — CID 141496450
2H-1,4-benzoxazine-2-thiol (PubChem CID 141496450) has the molecular formula C8H7NOS and a molecular weight of 165.22 g/mol. Its IUPAC name is 2H-1,4-benzoxazine-2-thiol.
| Compound Name | 2H-1,4-benzoxazine-2-thiol |
|---|---|
| PubChem CID | 141496450 |
| Molecular Formula | C8H7NOS |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.02 |
| IUPAC Name | 2H-1,4-benzoxazine-2-thiol |
| SMILES | SC1C=Nc2ccccc2O1 |
| InChI | InChI=1S/C8H7NOS/c11-8-5-9-6-3-1-2-4-7(6)10-8/h1-5,8,11H |
| InChIKey | JLEOEUYANDFXFZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 21.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|