C14H10BrNO2 — CID 71391889
3-(4-bromophenyl)-2H-1,4-benzoxazin-2-ol (PubChem CID 71391889) has the molecular formula C14H10BrNO2 and a molecular weight of 304.14 g/mol. Its IUPAC name is 3-(4-bromophenyl)-2H-1,4-benzoxazin-2-ol.
| Compound Name | 3-(4-bromophenyl)-2H-1,4-benzoxazin-2-ol |
|---|---|
| PubChem CID | 71391889 |
| Molecular Formula | C14H10BrNO2 |
| Molecular Weight | 304.14 g/mol |
| Exact Mass | 302.99 |
| IUPAC Name | 3-(4-bromophenyl)-2H-1,4-benzoxazin-2-ol |
| SMILES | OC1Oc2ccccc2N=C1c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H10BrNO2/c15-10-7-5-9(6-8-10)13-14(17)18-12-4-2-1-3-11(12)16-13/h1-8,14,17H |
| InChIKey | WMKPSAPVBQQSBK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.14 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |