C15H13NO2 — CID 642745
(2S)-2-methyl-3-phenyl-1,4-benzoxazin-2-ol (PubChem CID 642745) has the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. Its IUPAC name is (2S)-2-methyl-3-phenyl-1,4-benzoxazin-2-ol.
| Compound Name | (2S)-2-methyl-3-phenyl-1,4-benzoxazin-2-ol |
|---|---|
| PubChem CID | 642745 |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | (2S)-2-methyl-3-phenyl-1,4-benzoxazin-2-ol |
| SMILES | C[C@]1(O)Oc2ccccc2N=C1c1ccccc1 |
| InChI | InChI=1S/C15H13NO2/c1-15(17)14(11-7-3-2-4-8-11)16-12-9-5-6-10-13(12)18-15/h2-10,17H,1H3/t15-/m0/s1 |
| InChIKey | DNYXCFLPDIMFLQ-HNNXBMFYSA-N |
| XLogP | 2.91 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |