C21H23IrNO3 — CID 58983140
2,2-dimethyl-3-phenyl-1,4-benzoxazine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium (PubChem CID 58983140) has the molecular formula C21H23IrNO3 and a molecular weight of 529.64 g/mol. Its IUPAC name is 2,2-dimethyl-3-phenyl-1,4-benzoxazine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium.
| Compound Name | 2,2-dimethyl-3-phenyl-1,4-benzoxazine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium |
|---|---|
| PubChem CID | 58983140 |
| Molecular Formula | C21H23IrNO3 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | 2,2-dimethyl-3-phenyl-1,4-benzoxazine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium |
| SMILES | CC1(C)Oc2ccccc2N=C1c1[c-]cccc1.[H]/[O+]=C(C)/C=C(/C)O.[Ir] |
| InChI | InChI=1S/C16H14NO.C5H8O2.Ir/c1-16(2)15(12-8-4-3-5-9-12)17-13-10-6-7-11-14(13)18-16;1-4(6)3-5(2)7;/h3-8,10-11H,1-2H3;3,6H,1-2H3;/q-1;;/p+1/b;4-3-; |
| InChIKey | JKLKAYFATDIVJN-LWFKIUJUSA-O |
| XLogP | 4.79 |
| TPSA | 63.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|