C22H27IrNO2 — CID 58881158
[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;5,5,6,6-tetramethyl-10H-benzo[h]quinolin-10-ide (PubChem CID 58881158) has the molecular formula C22H27IrNO2 and a molecular weight of 529.68 g/mol. Its IUPAC name is [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;5,5,6,6-tetramethyl-10H-benzo[h]quinolin-10-ide.
| Compound Name | [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;5,5,6,6-tetramethyl-10H-benzo[h]quinolin-10-ide |
|---|---|
| PubChem CID | 58881158 |
| Molecular Formula | C22H27IrNO2 |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;5,5,6,6-tetramethyl-10H-benzo[h]quinolin-10-ide |
| SMILES | CC1(C)c2ccc[c-]c2-c2ncccc2C1(C)C.[H]/[O+]=C(C)/C=C(/C)O.[Ir] |
| InChI | InChI=1S/C17H18N.C5H8O2.Ir/c1-16(2)13-9-6-5-8-12(13)15-14(17(16,3)4)10-7-11-18-15;1-4(6)3-5(2)7;/h5-7,9-11H,1-4H3;3,6H,1-2H3;/q-1;;/p+1/b;4-3-; |
| InChIKey | NGEVFOAHEKQWFO-LWFKIUJUSA-O |
| XLogP | 5.13 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|