C24H26IrNO2- — CID 158700467
CID 158700467 (PubChem CID 158700467) has the molecular formula C24H26IrNO2- and a molecular weight of 552.69 g/mol.
| Compound Name | CID 158700467 |
|---|---|
| PubChem CID | 158700467 |
| Molecular Formula | C24H26IrNO2- |
| Molecular Weight | 552.69 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | — |
| SMILES | CC(=O)C=C(C)O.[Ir].[c-]1cccc2c1-c1ncccc1C13CCCC21CCC3 |
| InChI | InChI=1S/C19H18N.C5H8O2.Ir/c1-2-7-15-14(6-1)17-16(8-3-13-20-17)19-11-4-9-18(15,19)10-5-12-19;1-4(6)3-5(2)7;/h1-3,7-8,13H,4-5,9-12H2;3,6H,1-2H3;/q-1;; |
| InChIKey | MXGCYTMINLRTDR-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.69 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|