About CID 59522714
CID 59522714 (PubChem CID 59522714) has the molecular formula C23H16F6NO2Pt-
and a molecular weight of 647.45 g/mol.
Molecular Properties
| Compound Name | CID 59522714 |
| PubChem CID | 59522714 |
| Molecular Formula | C23H16F6NO2Pt- |
| Molecular Weight | 647.45 g/mol |
| Exact Mass | 647.07 |
| IUPAC Name | — |
| SMILES | CC(=O)/C=C(/C)O.FC(F)(F)C1(C(F)(F)F)c2ccc[c-]c2-c2nccc3cccc1c23.[Pt] |
| InChI | InChI=1S/C18H8F6N.C5H8O2.Pt/c19-17(20,21)16(18(22,23)24)12-6-2-1-5-11(12)15-14-10(8-9-25-15)4-3-7-13(14)16;1-4(6)3-5(2)7;/h1-4,6-9H;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | GQYBYHDHHGSCGO-LWFKIUJUSA-N |
| XLogP | 6.46 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 647.45 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 59522714 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59522714?
The IUPAC name of CID 59522714 (CID 59522714) is not available.
What is the SMILES notation for CID 59522714?
The canonical SMILES for CID 59522714 is CC(=O)/C=C(/C)O.FC(F)(F)C1(C(F)(F)F)c2ccc[c-]c2-c2nccc3cccc1c23.[Pt].
What is the InChIKey of CID 59522714?
The InChIKey is GQYBYHDHHGSCGO-LWFKIUJUSA-N. The full InChI is InChI=1S/C18H8F6N.C5H8O2.Pt/c19-17(20,21)16(18(22,23)24)12-6-2-1-5-11(12)15-14-10(8-9-25-15)4-3-7-13(14)16;1-4(6)3-5(2)7;/h1-4,6-9H;3,6H,1-2H3;/q-1;;/b;4-3-;.
What are the key properties of CID 59522714?
CID 59522714 has a molecular weight of 647.45 g/mol, XLogP of 6.46, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59522714 is sourced from PubChem (CID 59522714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).