C24H26IrNO2S- — CID 164727995
CID 164727995 (PubChem CID 164727995) has the molecular formula C24H26IrNO2S- and a molecular weight of 584.76 g/mol.
| Compound Name | CID 164727995 |
|---|---|
| PubChem CID | 164727995 |
| Molecular Formula | C24H26IrNO2S- |
| Molecular Weight | 584.76 g/mol |
| Exact Mass | 585.13 |
| IUPAC Name | — |
| SMILES | CC(=O)/C=C(/C)O.CC(C)c1cc2c3c(nccc3c1)-c1[c-]csc1C2(C)C.[Ir] |
| InChI | InChI=1S/C19H18NS.C5H8O2.Ir/c1-11(2)13-9-12-5-7-20-17-14-6-8-21-18(14)19(3,4)15(10-13)16(12)17;1-4(6)3-5(2)7;/h5,7-11H,1-4H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | LIQUFKVDDWDKDK-LWFKIUJUSA-N |
| XLogP | 6.56 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.76 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|