C34H40NO2Pt- — CID 162220643
CID 162220643 (PubChem CID 162220643) has the molecular formula C34H40NO2Pt- and a molecular weight of 689.78 g/mol.
| Compound Name | CID 162220643 |
|---|---|
| PubChem CID | 162220643 |
| Molecular Formula | C34H40NO2Pt- |
| Molecular Weight | 689.78 g/mol |
| Exact Mass | 689.27 |
| IUPAC Name | — |
| SMILES | CC(C)(C)C(=O)C=C(O)C(C)(C)C.[Pt].[c-]1cccc2c1-c1nc3ccccc3cc1C13CCCC21CCC3 |
| InChI | InChI=1S/C23H20N.C11H20O2.Pt/c1-4-10-20-16(7-1)15-19-21(24-20)17-8-2-3-9-18(17)22-11-5-13-23(19,22)14-6-12-22;1-10(2,3)8(12)7-9(13)11(4,5)6;/h1-4,7,9-10,15H,5-6,11-14H2;7,12H,1-6H3;/q-1;; |
| InChIKey | XAVCWEOMSYZZFC-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.78 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|