C23H26IrN2O3 — CID 58983236
5,5-dimethyl-3-phenyl-6-phenyl-4H-pyrimidin-2-one;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium (PubChem CID 58983236) has the molecular formula C23H26IrN2O3 and a molecular weight of 570.69 g/mol. Its IUPAC name is 5,5-dimethyl-3-phenyl-6-phenyl-4H-pyrimidin-2-one;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium.
| Compound Name | 5,5-dimethyl-3-phenyl-6-phenyl-4H-pyrimidin-2-one;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium |
|---|---|
| PubChem CID | 58983236 |
| Molecular Formula | C23H26IrN2O3 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 571.16 |
| IUPAC Name | 5,5-dimethyl-3-phenyl-6-phenyl-4H-pyrimidin-2-one;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium |
| SMILES | CC1(C)CN(c2ccccc2)C(=O)N=C1c1[c-]cccc1.[H]/[O+]=C(C)/C=C(/C)O.[Ir] |
| InChI | InChI=1S/C18H17N2O.C5H8O2.Ir/c1-18(2)13-20(15-11-7-4-8-12-15)17(21)19-16(18)14-9-5-3-6-10-14;1-4(6)3-5(2)7;/h3-9,11-12H,13H2,1-2H3;3,6H,1-2H3;/q-1;;/p+1/b;4-3-; |
| InChIKey | JEUKMHZEIMENBV-LWFKIUJUSA-O |
| XLogP | 4.95 |
| TPSA | 74.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|