C12H12IrNOS- — CID 58983176
4,4-dimethyl-2-phenyl-1,3-thiazin-5-one;iridium (PubChem CID 58983176) has the molecular formula C12H12IrNOS- and a molecular weight of 410.52 g/mol. Its IUPAC name is 4,4-dimethyl-2-phenyl-1,3-thiazin-5-one;iridium.
| Compound Name | 4,4-dimethyl-2-phenyl-1,3-thiazin-5-one;iridium |
|---|---|
| PubChem CID | 58983176 |
| Molecular Formula | C12H12IrNOS- |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | 4,4-dimethyl-2-phenyl-1,3-thiazin-5-one;iridium |
| SMILES | CC1(C)N=C(c2[c-]cccc2)SCC1=O.[Ir] |
| InChI | InChI=1S/C12H12NOS.Ir/c1-12(2)10(14)8-15-11(13-12)9-6-4-3-5-7-9;/h3-6H,8H2,1-2H3;/q-1; |
| InChIKey | OVDMAPRPASUYOA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|