C12H11IrN2- — CID 58894530
3,5-dimethyl-2-phenylpyrazine;iridium (PubChem CID 58894530) has the molecular formula C12H11IrN2- and a molecular weight of 375.45 g/mol. Its IUPAC name is 3,5-dimethyl-2-phenylpyrazine;iridium.
| Compound Name | 3,5-dimethyl-2-phenylpyrazine;iridium |
|---|---|
| PubChem CID | 58894530 |
| Molecular Formula | C12H11IrN2- |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 3,5-dimethyl-2-phenylpyrazine;iridium |
| SMILES | Cc1cnc(-c2[c-]cccc2)c(C)n1.[Ir] |
| InChI | InChI=1S/C12H11N2.Ir/c1-9-8-13-12(10(2)14-9)11-6-4-3-5-7-11;/h3-6,8H,1-2H3;/q-1; |
| InChIKey | OETLOSSAVVPVIS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|