C19H13IrN2- — CID 168852706
iridium;8-methyl-4-phenyl-3,7-phenanthroline (PubChem CID 168852706) has the molecular formula C19H13IrN2- and a molecular weight of 461.54 g/mol. Its IUPAC name is iridium;8-methyl-4-phenyl-3,7-phenanthroline.
| Compound Name | iridium;8-methyl-4-phenyl-3,7-phenanthroline |
|---|---|
| PubChem CID | 168852706 |
| Molecular Formula | C19H13IrN2- |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | iridium;8-methyl-4-phenyl-3,7-phenanthroline |
| SMILES | Cc1ccc2c(ccc3c(-c4[c-]cccc4)nccc32)n1.[Ir] |
| InChI | InChI=1S/C19H13N2.Ir/c1-13-7-8-16-15-11-12-20-19(14-5-3-2-4-6-14)17(15)9-10-18(16)21-13;/h2-5,7-12H,1H3;/q-1; |
| InChIKey | JJEKKUIJPBRZMK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|