C41H38IrN3+ — CID 160540235
bis(3,4-dimethyl-2-phenylpyridin-1-ium);iridium;1-phenylisoquinoline (PubChem CID 160540235) has the molecular formula C41H38IrN3+ and a molecular weight of 764.99 g/mol. Its IUPAC name is bis(3,4-dimethyl-2-phenylpyridin-1-ium);iridium;1-phenylisoquinoline.
| Compound Name | bis(3,4-dimethyl-2-phenylpyridin-1-ium);iridium;1-phenylisoquinoline |
|---|---|
| PubChem CID | 160540235 |
| Molecular Formula | C41H38IrN3+ |
| Molecular Weight | 764.99 g/mol |
| Exact Mass | 765.27 |
| IUPAC Name | bis(3,4-dimethyl-2-phenylpyridin-1-ium);iridium;1-phenylisoquinoline |
| SMILES | Cc1cc[nH+]c(-c2ccccc2)c1C.Cc1cc[nH+]c(-c2ccccc2)c1C.[Ir].[c-]1ccccc1-c1nccc2ccccc12 |
| InChI | InChI=1S/C15H10N.2C13H13N.Ir/c1-2-7-13(8-3-1)15-14-9-5-4-6-12(14)10-11-16-15;2*1-10-8-9-14-13(11(10)2)12-6-4-3-5-7-12;/h1-7,9-11H;2*3-9H,1-2H3;/q-1;;;/p+2 |
| InChIKey | OSLNWJBMDBZXIG-UHFFFAOYSA-P |
| XLogP | 9.27 |
| TPSA | 41.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.99 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|