C25H16IrN- — CID 59470319
iridium;7-phenyl-4-phenylbenzo[f]isoquinoline (PubChem CID 59470319) has the molecular formula C25H16IrN- and a molecular weight of 522.63 g/mol. Its IUPAC name is iridium;7-phenyl-4-phenylbenzo[f]isoquinoline.
| Compound Name | iridium;7-phenyl-4-phenylbenzo[f]isoquinoline |
|---|---|
| PubChem CID | 59470319 |
| Molecular Formula | C25H16IrN- |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 523.09 |
| IUPAC Name | iridium;7-phenyl-4-phenylbenzo[f]isoquinoline |
| SMILES | [Ir].[c-]1ccccc1-c1nccc2c1ccc1c(-c3ccccc3)cccc12 |
| InChI | InChI=1S/C25H16N.Ir/c1-3-8-18(9-4-1)20-12-7-13-21-22(20)14-15-24-23(21)16-17-26-25(24)19-10-5-2-6-11-19;/h1-10,12-17H;/q-1; |
| InChIKey | ZVMBBZBAOXPBTC-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|