C11H12LiNO — CID 134844683
lithium 2,2-dimethyl-4-phenyl-5H-1,3-oxazole (PubChem CID 134844683) has the molecular formula C11H12LiNO and a molecular weight of 181.16 g/mol. Its IUPAC name is lithium 2,2-dimethyl-4-phenyl-5H-1,3-oxazole.
| Compound Name | lithium 2,2-dimethyl-4-phenyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 134844683 |
| Molecular Formula | C11H12LiNO |
| Molecular Weight | 181.16 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | lithium 2,2-dimethyl-4-phenyl-5H-1,3-oxazole |
| SMILES | CC1(C)N=C(c2[c-]cccc2)CO1.[Li+] |
| InChI | InChI=1S/C11H12NO.Li/c1-11(2)12-10(8-13-11)9-6-4-3-5-7-9;/h3-6H,8H2,1-2H3;/q-1;+1 |
| InChIKey | UZYBMRFUOVFPIE-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.16 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|