C19H20IrN- — CID 58982990
iridium;3,3,4,4-tetramethyl-2-phenylquinoline (PubChem CID 58982990) has the molecular formula C19H20IrN- and a molecular weight of 454.59 g/mol. Its IUPAC name is iridium;3,3,4,4-tetramethyl-2-phenylquinoline.
| Compound Name | iridium;3,3,4,4-tetramethyl-2-phenylquinoline |
|---|---|
| PubChem CID | 58982990 |
| Molecular Formula | C19H20IrN- |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | iridium;3,3,4,4-tetramethyl-2-phenylquinoline |
| SMILES | CC1(C)C(c2[c-]cccc2)=Nc2ccccc2C1(C)C.[Ir] |
| InChI | InChI=1S/C19H20N.Ir/c1-18(2)15-12-8-9-13-16(15)20-17(19(18,3)4)14-10-6-5-7-11-14;/h5-10,12-13H,1-4H3;/q-1; |
| InChIKey | HNFVQEWOBCINFJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|