C20H27N — CID 90996712
3,3-dimethyl-2-phenylindole;ethane (PubChem CID 90996712) has the molecular formula C20H27N and a molecular weight of 281.44 g/mol. Its IUPAC name is 3,3-dimethyl-2-phenylindole;ethane.
| Compound Name | 3,3-dimethyl-2-phenylindole;ethane |
|---|---|
| PubChem CID | 90996712 |
| Molecular Formula | C20H27N |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 3,3-dimethyl-2-phenylindole;ethane |
| SMILES | CC.CC.CC1(C)C(c2ccccc2)=Nc2ccccc21 |
| InChI | InChI=1S/C16H15N.2C2H6/c1-16(2)13-10-6-7-11-14(13)17-15(16)12-8-4-3-5-9-12;2*1-2/h3-11H,1-2H3;2*1-2H3 |
| InChIKey | URGPRPHEGMPMEB-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |