C18H16N4O2 — CID 139220049
6-(3,3-dimethylindol-2-yl)-1-methylpyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 139220049) has the molecular formula C18H16N4O2 and a molecular weight of 320.35 g/mol. Its IUPAC name is 6-(3,3-dimethylindol-2-yl)-1-methylpyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 6-(3,3-dimethylindol-2-yl)-1-methylpyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 139220049 |
| Molecular Formula | C18H16N4O2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 6-(3,3-dimethylindol-2-yl)-1-methylpyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2cc(C3=Nc4ccccc4C3(C)C)cnc21 |
| InChI | InChI=1S/C18H16N4O2/c1-18(2)12-6-4-5-7-13(12)20-14(18)10-8-11-15(19-9-10)22(3)17(24)21-16(11)23/h4-9H,1-3H3,(H,21,23,24) |
| InChIKey | FCTLGWBSHJYYEY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 80.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |