C18H17N3O4 — CID 167981393
1-phenylpropyl 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylate (PubChem CID 167981393) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is 1-phenylpropyl 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | 1-phenylpropyl 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 167981393 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 1-phenylpropyl 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCC(OC(=O)c1cnc2c(c1)c(=O)[nH]c(=O)n2C)c1ccccc1 |
| InChI | InChI=1S/C18H17N3O4/c1-3-14(11-7-5-4-6-8-11)25-17(23)12-9-13-15(19-10-12)21(2)18(24)20-16(13)22/h4-10,14H,3H2,1-2H3,(H,20,22,24) |
| InChIKey | HFFOJFWINFGGHR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |