C20H22N4O3 — CID 42943182
1-ethyl-2,4-dioxo-N-(1-phenylbutyl)pyrido[2,3-d]pyrimidine-6-carboxamide (PubChem CID 42943182) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is 1-ethyl-2,4-dioxo-N-(1-phenylbutyl)pyrido[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 1-ethyl-2,4-dioxo-N-(1-phenylbutyl)pyrido[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 42943182 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 1-ethyl-2,4-dioxo-N-(1-phenylbutyl)pyrido[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CCCC(NC(=O)c1cnc2c(c1)c(=O)[nH]c(=O)n2CC)c1ccccc1 |
| InChI | InChI=1S/C20H22N4O3/c1-3-8-16(13-9-6-5-7-10-13)22-18(25)14-11-15-17(21-12-14)24(4-2)20(27)23-19(15)26/h5-7,9-12,16H,3-4,8H2,1-2H3,(H,22,25)(H,23,26,27) |
| InChIKey | KQMQXLVICQIORT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |