C12H9N5O3 — CID 11065540
8-methyl-4-oxido-3-phenylpyrimido[5,4-e][1,2,4]triazin-4-ium-5,7-dione (PubChem CID 11065540) has the molecular formula C12H9N5O3 and a molecular weight of 271.24 g/mol. Its IUPAC name is 8-methyl-4-oxido-3-phenylpyrimido[5,4-e][1,2,4]triazin-4-ium-5,7-dione.
| Compound Name | 8-methyl-4-oxido-3-phenylpyrimido[5,4-e][1,2,4]triazin-4-ium-5,7-dione |
|---|---|
| PubChem CID | 11065540 |
| Molecular Formula | C12H9N5O3 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 8-methyl-4-oxido-3-phenylpyrimido[5,4-e][1,2,4]triazin-4-ium-5,7-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nnc(-c1ccccc1)[n+]2[O-] |
| InChI | InChI=1S/C12H9N5O3/c1-16-10-8(11(18)13-12(16)19)17(20)9(14-15-10)7-5-3-2-4-6-7/h2-6H,1H3,(H,13,18,19) |
| InChIKey | XGBNDUSNZDSXFP-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 107.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|