C13H11N3O2 — CID 141408853
1-methyl-5-phenyl-6H-pyrrolo[3,4-d]pyrimidine-2,4-dione (PubChem CID 141408853) has the molecular formula C13H11N3O2 and a molecular weight of 241.25 g/mol. Its IUPAC name is 1-methyl-5-phenyl-6H-pyrrolo[3,4-d]pyrimidine-2,4-dione.
| Compound Name | 1-methyl-5-phenyl-6H-pyrrolo[3,4-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 141408853 |
| Molecular Formula | C13H11N3O2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 1-methyl-5-phenyl-6H-pyrrolo[3,4-d]pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c(-c3ccccc3)[nH]cc21 |
| InChI | InChI=1S/C13H11N3O2/c1-16-9-7-14-11(8-5-3-2-4-6-8)10(9)12(17)15-13(16)18/h2-7,14H,1H3,(H,15,17,18) |
| InChIKey | NEVULCDFQRSXEE-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 70.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |