C16H15N7O2 — CID 13238127
8-[(E)-hydrazinylidenemethyl]-4,6-dimethyl-7-phenylpurino[7,8-a]imidazole-1,3-dione (PubChem CID 13238127) has the molecular formula C16H15N7O2 and a molecular weight of 337.34 g/mol. Its IUPAC name is 8-[(E)-hydrazinylidenemethyl]-4,6-dimethyl-7-phenylpurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 8-[(E)-hydrazinylidenemethyl]-4,6-dimethyl-7-phenylpurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 13238127 |
| Molecular Formula | C16H15N7O2 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 8-[(E)-hydrazinylidenemethyl]-4,6-dimethyl-7-phenylpurino[7,8-a]imidazole-1,3-dione |
| SMILES | Cn1c(-c2ccccc2)c(/C=N/N)n2c3c(=O)[nH]c(=O)n(C)c3nc12 |
| InChI | InChI=1S/C16H15N7O2/c1-21-11(9-6-4-3-5-7-9)10(8-18-17)23-12-13(19-15(21)23)22(2)16(25)20-14(12)24/h3-8H,17H2,1-2H3,(H,20,24,25)/b18-8+ |
| InChIKey | FVSAAZOWLDXHCB-QGMBQPNBSA-N |
| XLogP | 0.17 |
| TPSA | 115.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|