C23H18N8O4 — CID 13238132
4,6-dimethyl-8-[(E)-[(E)-(4-nitrophenyl)methylidenehydrazinylidene]methyl]-7-phenylpurino[7,8-a]imidazole-1,3-dione (PubChem CID 13238132) has the molecular formula C23H18N8O4 and a molecular weight of 470.45 g/mol. Its IUPAC name is 4,6-dimethyl-8-[(E)-[(E)-(4-nitrophenyl)methylidenehydrazinylidene]methyl]-7-phenylpurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 4,6-dimethyl-8-[(E)-[(E)-(4-nitrophenyl)methylidenehydrazinylidene]methyl]-7-phenylpurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 13238132 |
| Molecular Formula | C23H18N8O4 |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 4,6-dimethyl-8-[(E)-[(E)-(4-nitrophenyl)methylidenehydrazinylidene]methyl]-7-phenylpurino[7,8-a]imidazole-1,3-dione |
| SMILES | Cn1c(-c2ccccc2)c(/C=N/N=C/c2ccc([N+](=O)[O-])cc2)n2c3c(=O)[nH]c(=O)n(C)c3nc12 |
| InChI | InChI=1S/C23H18N8O4/c1-28-18(15-6-4-3-5-7-15)17(13-25-24-12-14-8-10-16(11-9-14)31(34)35)30-19-20(26-22(28)30)29(2)23(33)27-21(19)32/h3-13H,1-2H3,(H,27,32,33)/b24-12+,25-13+ |
| InChIKey | LEJLFYKABYHIAA-DWGHPKEWSA-N |
| XLogP | 2.24 |
| TPSA | 144.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|