C26H20ClN7O4 — CID 3452510
8-[2-[2-chloro-3-(4-nitrophenyl)prop-2-enylidene]hydrazinyl]-3-methyl-7-(naphthalen-1-ylmethyl)purine-2,6-dione (PubChem CID 3452510) has the molecular formula C26H20ClN7O4 and a molecular weight of 529.94 g/mol. Its IUPAC name is 8-[2-[2-chloro-3-(4-nitrophenyl)prop-2-enylidene]hydrazinyl]-3-methyl-7-(naphthalen-1-ylmethyl)purine-2,6-dione.
| Compound Name | 8-[2-[2-chloro-3-(4-nitrophenyl)prop-2-enylidene]hydrazinyl]-3-methyl-7-(naphthalen-1-ylmethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 3452510 |
| Molecular Formula | C26H20ClN7O4 |
| Molecular Weight | 529.94 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | 8-[2-[2-chloro-3-(4-nitrophenyl)prop-2-enylidene]hydrazinyl]-3-methyl-7-(naphthalen-1-ylmethyl)purine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(NN=CC(Cl)=Cc1ccc([N+](=O)[O-])cc1)n2Cc1cccc2ccccc12 |
| InChI | InChI=1S/C26H20ClN7O4/c1-32-23-22(24(35)30-26(32)36)33(15-18-7-4-6-17-5-2-3-8-21(17)18)25(29-23)31-28-14-19(27)13-16-9-11-20(12-10-16)34(37)38/h2-14H,15H2,1H3,(H,29,31)(H,30,35,36) |
| InChIKey | ZCZNNPYXBTZHDL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 140.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.94 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|