C25H19ClN8O4 — CID 154734890
8-[[[2-chloro-3-(4-nitrophenyl)prop-2-enylidene]hydrazinylidene]methyl]-4,6-dimethyl-7-phenylpurino[7,8-a]imidazole-1,3-dione (PubChem CID 154734890) has the molecular formula C25H19ClN8O4 and a molecular weight of 530.93 g/mol. Its IUPAC name is 8-[[[2-chloro-3-(4-nitrophenyl)prop-2-enylidene]hydrazinylidene]methyl]-4,6-dimethyl-7-phenylpurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 8-[[[2-chloro-3-(4-nitrophenyl)prop-2-enylidene]hydrazinylidene]methyl]-4,6-dimethyl-7-phenylpurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 154734890 |
| Molecular Formula | C25H19ClN8O4 |
| Molecular Weight | 530.93 g/mol |
| Exact Mass | 530.12 |
| IUPAC Name | 8-[[[2-chloro-3-(4-nitrophenyl)prop-2-enylidene]hydrazinylidene]methyl]-4,6-dimethyl-7-phenylpurino[7,8-a]imidazole-1,3-dione |
| SMILES | Cn1c(-c2ccccc2)c(C=NN=CC(Cl)=Cc2ccc([N+](=O)[O-])cc2)n2c3c(=O)[nH]c(=O)n(C)c3nc12 |
| InChI | InChI=1S/C25H19ClN8O4/c1-31-20(16-6-4-3-5-7-16)19(33-21-22(29-24(31)33)32(2)25(36)30-23(21)35)14-28-27-13-17(26)12-15-8-10-18(11-9-15)34(37)38/h3-14H,1-2H3,(H,30,35,36) |
| InChIKey | UVKBGNICLQJBCF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 144.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.93 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|