C23H21N5O2 — CID 11452333
4-benzyl-7-phenyl-2-propyl-6H-purino[7,8-a]imidazole-1,3-dione (PubChem CID 11452333) has the molecular formula C23H21N5O2 and a molecular weight of 399.45 g/mol. Its IUPAC name is 4-benzyl-7-phenyl-2-propyl-6H-purino[7,8-a]imidazole-1,3-dione.
| Compound Name | 4-benzyl-7-phenyl-2-propyl-6H-purino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 11452333 |
| Molecular Formula | C23H21N5O2 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 4-benzyl-7-phenyl-2-propyl-6H-purino[7,8-a]imidazole-1,3-dione |
| SMILES | CCCn1c(=O)c2c(nc3[nH]c(-c4ccccc4)cn32)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C23H21N5O2/c1-2-13-26-21(29)19-20(28(23(26)30)14-16-9-5-3-6-10-16)25-22-24-18(15-27(19)22)17-11-7-4-8-12-17/h3-12,15H,2,13-14H2,1H3,(H,24,25) |
| InChIKey | UEXAJGWZPXRZGA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 77.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |