C20H23N5O2 — CID 91901187
6-hexyl-4-methyl-7-phenylpurino[7,8-a]imidazole-1,3-dione (PubChem CID 91901187) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is 6-hexyl-4-methyl-7-phenylpurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 6-hexyl-4-methyl-7-phenylpurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 91901187 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 6-hexyl-4-methyl-7-phenylpurino[7,8-a]imidazole-1,3-dione |
| SMILES | CCCCCCn1c(-c2ccccc2)cn2c3c(=O)[nH]c(=O)n(C)c3nc12 |
| InChI | InChI=1S/C20H23N5O2/c1-3-4-5-9-12-24-15(14-10-7-6-8-11-14)13-25-16-17(21-19(24)25)23(2)20(27)22-18(16)26/h6-8,10-11,13H,3-5,9,12H2,1-2H3,(H,22,26,27) |
| InChIKey | RBORKQOCQKNBBW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 77.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|