C30H38N6O3 — CID 143836700
4-benzyl-7-[4-(butylamino)phenyl]-6-(4-hydroxybutyl)purino[7,8-a]imidazole-1,3-dione;ethane (PubChem CID 143836700) has the molecular formula C30H38N6O3 and a molecular weight of 530.67 g/mol. Its IUPAC name is 4-benzyl-7-[4-(butylamino)phenyl]-6-(4-hydroxybutyl)purino[7,8-a]imidazole-1,3-dione;ethane.
| Compound Name | 4-benzyl-7-[4-(butylamino)phenyl]-6-(4-hydroxybutyl)purino[7,8-a]imidazole-1,3-dione;ethane |
|---|---|
| PubChem CID | 143836700 |
| Molecular Formula | C30H38N6O3 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.30 |
| IUPAC Name | 4-benzyl-7-[4-(butylamino)phenyl]-6-(4-hydroxybutyl)purino[7,8-a]imidazole-1,3-dione;ethane |
| SMILES | CC.CCCCNc1ccc(-c2cn3c4c(=O)[nH]c(=O)n(Cc5ccccc5)c4nc3n2CCCCO)cc1 |
| InChI | InChI=1S/C28H32N6O3.C2H6/c1-2-3-15-29-22-13-11-21(12-14-22)23-19-33-24-25(30-27(33)32(23)16-7-8-17-35)34(28(37)31-26(24)36)18-20-9-5-4-6-10-20;1-2/h4-6,9-14,19,29,35H,2-3,7-8,15-18H2,1H3,(H,31,36,37);1-2H3 |
| InChIKey | ZRVREMFNVPKQSS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 109.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|