C15H20N4O2 — CID 3828480
6-amino-1-benzyl-5-(butylamino)pyrimidine-2,4-dione (PubChem CID 3828480) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 6-amino-1-benzyl-5-(butylamino)pyrimidine-2,4-dione.
| Compound Name | 6-amino-1-benzyl-5-(butylamino)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3828480 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 6-amino-1-benzyl-5-(butylamino)pyrimidine-2,4-dione |
| SMILES | CCCCNc1c(N)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H20N4O2/c1-2-3-9-17-12-13(16)19(15(21)18-14(12)20)10-11-7-5-4-6-8-11/h4-8,17H,2-3,9-10,16H2,1H3,(H,18,20,21) |
| InChIKey | GVZZVBJHHDAYPH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|