C14H15ClN4O2 — CID 115637277
6-amino-1-benzyl-5-(2-chloroprop-2-enylamino)pyrimidine-2,4-dione (PubChem CID 115637277) has the molecular formula C14H15ClN4O2 and a molecular weight of 306.75 g/mol. Its IUPAC name is 6-amino-1-benzyl-5-(2-chloroprop-2-enylamino)pyrimidine-2,4-dione.
| Compound Name | 6-amino-1-benzyl-5-(2-chloroprop-2-enylamino)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 115637277 |
| Molecular Formula | C14H15ClN4O2 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 6-amino-1-benzyl-5-(2-chloroprop-2-enylamino)pyrimidine-2,4-dione |
| SMILES | C=C(Cl)CNc1c(N)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H15ClN4O2/c1-9(15)7-17-11-12(16)19(14(21)18-13(11)20)8-10-5-3-2-4-6-10/h2-6,17H,1,7-8,16H2,(H,18,20,21) |
| InChIKey | OQKCALIHWZEOTR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |