C16H22N4O3S — CID 113254298
6-amino-1-benzyl-5-(4-methylsulfinylbutan-2-ylamino)pyrimidine-2,4-dione (PubChem CID 113254298) has the molecular formula C16H22N4O3S and a molecular weight of 350.44 g/mol. Its IUPAC name is 6-amino-1-benzyl-5-(4-methylsulfinylbutan-2-ylamino)pyrimidine-2,4-dione.
| Compound Name | 6-amino-1-benzyl-5-(4-methylsulfinylbutan-2-ylamino)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 113254298 |
| Molecular Formula | C16H22N4O3S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 6-amino-1-benzyl-5-(4-methylsulfinylbutan-2-ylamino)pyrimidine-2,4-dione |
| SMILES | CC(CCS(C)=O)Nc1c(N)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H22N4O3S/c1-11(8-9-24(2)23)18-13-14(17)20(16(22)19-15(13)21)10-12-6-4-3-5-7-12/h3-7,11,18H,8-10,17H2,1-2H3,(H,19,21,22) |
| InChIKey | OVJSUHPGZZIBOK-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |