C19H26N6O4 — CID 55478282
2-[(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-methylamino]-N-(butylcarbamoyl)acetamide (PubChem CID 55478282) has the molecular formula C19H26N6O4 and a molecular weight of 402.46 g/mol. Its IUPAC name is 2-[(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-methylamino]-N-(butylcarbamoyl)acetamide.
| Compound Name | 2-[(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-methylamino]-N-(butylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 55478282 |
| Molecular Formula | C19H26N6O4 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 2-[(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-methylamino]-N-(butylcarbamoyl)acetamide |
| SMILES | CCCCNC(=O)NC(=O)CN(C)c1c(N)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H26N6O4/c1-3-4-10-21-18(28)22-14(26)12-24(2)15-16(20)25(19(29)23-17(15)27)11-13-8-6-5-7-9-13/h5-9H,3-4,10-12,20H2,1-2H3,(H,23,27,29)(H2,21,22,26,28) |
| InChIKey | YNDZLQBYCDJGMY-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 142.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|