C24H28N6O4 — CID 55387278
2-[(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 55387278) has the molecular formula C24H28N6O4 and a molecular weight of 464.53 g/mol. Its IUPAC name is 2-[(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 55387278 |
| Molecular Formula | C24H28N6O4 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | 2-[(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | CN(CC(=O)Nc1ccc(N2CCOCC2)cc1)c1c(N)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C24H28N6O4/c1-28(16-20(31)26-18-7-9-19(10-8-18)29-11-13-34-14-12-29)21-22(25)30(24(33)27-23(21)32)15-17-5-3-2-4-6-17/h2-10H,11-16,25H2,1H3,(H,26,31)(H,27,32,33) |
| InChIKey | IXVLKQLGCTUWBG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 125.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|