C20H30N6O2S — CID 9093509
1-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-3-[3-(dimethylamino)propyl]-1-propylthiourea (PubChem CID 9093509) has the molecular formula C20H30N6O2S and a molecular weight of 418.57 g/mol. Its IUPAC name is 1-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-3-[3-(dimethylamino)propyl]-1-propylthiourea.
| Compound Name | 1-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-3-[3-(dimethylamino)propyl]-1-propylthiourea |
|---|---|
| PubChem CID | 9093509 |
| Molecular Formula | C20H30N6O2S |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 1-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-3-[3-(dimethylamino)propyl]-1-propylthiourea |
| SMILES | CCCN(C(=S)NCCCN(C)C)c1c(N)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H30N6O2S/c1-4-12-25(20(29)22-11-8-13-24(2)3)16-17(21)26(19(28)23-18(16)27)14-15-9-6-5-7-10-15/h5-7,9-10H,4,8,11-14,21H2,1-3H3,(H,22,29)(H,23,27,28) |
| InChIKey | ZXEYFXDZUVIRTP-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 99.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|