C15H14N6O2 — CID 4891461
6-(2-aminophenyl)-4,7-dimethylpurino[7,8-a]imidazole-1,3-dione (PubChem CID 4891461) has the molecular formula C15H14N6O2 and a molecular weight of 310.32 g/mol. Its IUPAC name is 6-(2-aminophenyl)-4,7-dimethylpurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 6-(2-aminophenyl)-4,7-dimethylpurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 4891461 |
| Molecular Formula | C15H14N6O2 |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 6-(2-aminophenyl)-4,7-dimethylpurino[7,8-a]imidazole-1,3-dione |
| SMILES | Cc1cn2c3c(=O)[nH]c(=O)n(C)c3nc2n1-c1ccccc1N |
| InChI | InChI=1S/C15H14N6O2/c1-8-7-20-11-12(19(2)15(23)18-13(11)22)17-14(20)21(8)10-6-4-3-5-9(10)16/h3-7H,16H2,1-2H3,(H,18,22,23) |
| InChIKey | XZJRQMICJSDCKL-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 103.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|