C14H10FN3O2 — CID 110171943
6-(4-fluorophenyl)-1-methylpyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 110171943) has the molecular formula C14H10FN3O2 and a molecular weight of 271.25 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-1-methylpyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 6-(4-fluorophenyl)-1-methylpyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 110171943 |
| Molecular Formula | C14H10FN3O2 |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 6-(4-fluorophenyl)-1-methylpyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2cc(-c3ccc(F)cc3)cnc21 |
| InChI | InChI=1S/C14H10FN3O2/c1-18-12-11(13(19)17-14(18)20)6-9(7-16-12)8-2-4-10(15)5-3-8/h2-7H,1H3,(H,17,19,20) |
| InChIKey | OKQVVXDSLJKSCO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |